C19H11F3IN3O4S — CID 3893261
N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 3893261) has the molecular formula C19H11F3IN3O4S and a molecular weight of 561.28 g/mol. Its IUPAC name is N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3893261 |
| Molecular Formula | C19H11F3IN3O4S |
| Molecular Weight | 561.28 g/mol |
| Exact Mass | 560.95 |
| IUPAC Name | N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1C(F)(F)F)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C19H11F3IN3O4S/c20-19(21,22)13-9-11(23)4-5-14(13)24-18(31)25-17(27)16-7-6-15(30-16)10-2-1-3-12(8-10)26(28)29/h1-9H,(H2,24,25,27,31) |
| InChIKey | MICYPYRJHILDKH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|