C20H13ClF3IN2O2S — CID 17317037
5-(3-chloro-4-methylphenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17317037) has the molecular formula C20H13ClF3IN2O2S and a molecular weight of 564.75 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chloro-4-methylphenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17317037 |
| Molecular Formula | C20H13ClF3IN2O2S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NC(=S)Nc3ccc(I)cc3C(F)(F)F)o2)cc1Cl |
| InChI | InChI=1S/C20H13ClF3IN2O2S/c1-10-2-3-11(8-14(10)21)16-6-7-17(29-16)18(28)27-19(30)26-15-5-4-12(25)9-13(15)20(22,23)24/h2-9H,1H3,(H2,26,27,28,30) |
| InChIKey | QYUZJFNCBFIUDE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|