C15H8BrClF3IN2OS — CID 3506644
5-bromo-2-chloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 3506644) has the molecular formula C15H8BrClF3IN2OS and a molecular weight of 563.56 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3506644 |
| Molecular Formula | C15H8BrClF3IN2OS |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 561.82 |
| IUPAC Name | 5-bromo-2-chloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1C(F)(F)F)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H8BrClF3IN2OS/c16-7-1-3-11(17)9(5-7)13(24)23-14(25)22-12-4-2-8(21)6-10(12)15(18,19)20/h1-6H,(H2,22,23,24,25) |
| InChIKey | IBOQJQIAENJEGW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|