C14H8Cl3IN2OS — CID 2202064
2-chloro-N-[(2,4-dichlorophenyl)carbamothioyl]-5-iodobenzamide (PubChem CID 2202064) has the molecular formula C14H8Cl3IN2OS and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-dichlorophenyl)carbamothioyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[(2,4-dichlorophenyl)carbamothioyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 2202064 |
| Molecular Formula | C14H8Cl3IN2OS |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 483.85 |
| IUPAC Name | 2-chloro-N-[(2,4-dichlorophenyl)carbamothioyl]-5-iodobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cl)cc1Cl)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C14H8Cl3IN2OS/c15-7-1-4-12(11(17)5-7)19-14(22)20-13(21)9-6-8(18)2-3-10(9)16/h1-6H,(H2,19,20,21,22) |
| InChIKey | LIYPHCBNUWISEQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|