C17H14Cl2IN3O2S — CID 17317202
2-chloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-5-iodobenzamide (PubChem CID 17317202) has the molecular formula C17H14Cl2IN3O2S and a molecular weight of 522.20 g/mol. Its IUPAC name is 2-chloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 17317202 |
| Molecular Formula | C17H14Cl2IN3O2S |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 520.92 |
| IUPAC Name | 2-chloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-5-iodobenzamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2cc(I)ccc2Cl)c1 |
| InChI | InChI=1S/C17H14Cl2IN3O2S/c1-2-15(24)21-10-4-6-13(19)14(8-10)22-17(26)23-16(25)11-7-9(20)3-5-12(11)18/h3-8H,2H2,1H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | DAKCRRUVOOJGRQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|