C20H15ClIN3O3S — CID 17313305
N-[3-[(2-chloro-5-iodobenzoyl)carbamothioylamino]-4-methylphenyl]furan-2-carboxamide (PubChem CID 17313305) has the molecular formula C20H15ClIN3O3S and a molecular weight of 539.78 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-iodobenzoyl)carbamothioylamino]-4-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(2-chloro-5-iodobenzoyl)carbamothioylamino]-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17313305 |
| Molecular Formula | C20H15ClIN3O3S |
| Molecular Weight | 539.78 g/mol |
| Exact Mass | 538.96 |
| IUPAC Name | N-[3-[(2-chloro-5-iodobenzoyl)carbamothioylamino]-4-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccco2)cc1NC(=S)NC(=O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C20H15ClIN3O3S/c1-11-4-6-13(23-19(27)17-3-2-8-28-17)10-16(11)24-20(29)25-18(26)14-9-12(22)5-7-15(14)21/h2-10H,1H3,(H,23,27)(H2,24,25,26,29) |
| InChIKey | MCYMHWMTWAKGSG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.78 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|