C24H17Cl2N3O4S — CID 17335701
5-(2,3-dichlorophenyl)-N-[[5-(furan-2-carbonylamino)-2-methylphenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17335701) has the molecular formula C24H17Cl2N3O4S and a molecular weight of 514.39 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[[5-(furan-2-carbonylamino)-2-methylphenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[[5-(furan-2-carbonylamino)-2-methylphenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17335701 |
| Molecular Formula | C24H17Cl2N3O4S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[[5-(furan-2-carbonylamino)-2-methylphenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccco2)cc1NC(=S)NC(=O)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C24H17Cl2N3O4S/c1-13-7-8-14(27-22(30)19-6-3-11-32-19)12-17(13)28-24(34)29-23(31)20-10-9-18(33-20)15-4-2-5-16(25)21(15)26/h2-12H,1H3,(H,27,30)(H2,28,29,31,34) |
| InChIKey | HMZXLEZMDIWWAG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|