C26H19Cl2N3O3S — CID 4010622
5-(2,3-dichlorophenyl)-N-[[3-[(2-methylbenzoyl)amino]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 4010622) has the molecular formula C26H19Cl2N3O3S and a molecular weight of 524.43 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[[3-[(2-methylbenzoyl)amino]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[[3-[(2-methylbenzoyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4010622 |
| Molecular Formula | C26H19Cl2N3O3S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[[3-[(2-methylbenzoyl)amino]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(NC(=S)NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)c1 |
| InChI | InChI=1S/C26H19Cl2N3O3S/c1-15-6-2-3-9-18(15)24(32)29-16-7-4-8-17(14-16)30-26(35)31-25(33)22-13-12-21(34-22)19-10-5-11-20(27)23(19)28/h2-14H,1H3,(H,29,32)(H2,30,31,33,35) |
| InChIKey | QHOXFFNQUMMEHB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|