C22H15Cl2N3O2S — CID 17313884
5-(2,3-dichlorophenyl)-N-[(2-methylquinolin-5-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 17313884) has the molecular formula C22H15Cl2N3O2S and a molecular weight of 456.35 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[(2-methylquinolin-5-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[(2-methylquinolin-5-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17313884 |
| Molecular Formula | C22H15Cl2N3O2S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[(2-methylquinolin-5-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc2c(NC(=S)NC(=O)c3ccc(-c4cccc(Cl)c4Cl)o3)cccc2n1 |
| InChI | InChI=1S/C22H15Cl2N3O2S/c1-12-8-9-13-16(25-12)6-3-7-17(13)26-22(30)27-21(28)19-11-10-18(29-19)14-4-2-5-15(23)20(14)24/h2-11H,1H3,(H2,26,27,28,30) |
| InChIKey | CHESFCMWTQYFKQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|