C25H16Cl2N4O3S — CID 2066774
5-(2,3-dichlorophenyl)-N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 2066774) has the molecular formula C25H16Cl2N4O3S and a molecular weight of 523.40 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2066774 |
| Molecular Formula | C25H16Cl2N4O3S |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2nc3ncccc3o2)cc1NC(=S)NC(=O)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H16Cl2N4O3S/c1-13-7-8-14(24-30-22-19(34-24)6-3-11-28-22)12-17(13)29-25(35)31-23(32)20-10-9-18(33-20)15-4-2-5-16(26)21(15)27/h2-12H,1H3,(H2,29,31,32,35) |
| InChIKey | XFHKSBWXRYBMGC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|