C21H14Cl2N4O2S — CID 17104228
2-chloro-N-[[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-4-methylbenzamide (PubChem CID 17104228) has the molecular formula C21H14Cl2N4O2S and a molecular weight of 457.34 g/mol. Its IUPAC name is 2-chloro-N-[[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 17104228 |
| Molecular Formula | C21H14Cl2N4O2S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-chloro-N-[[2-chloro-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4ncccc4o3)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N4O2S/c1-11-4-6-13(15(23)9-11)19(28)27-21(30)25-16-10-12(5-7-14(16)22)20-26-18-17(29-20)3-2-8-24-18/h2-10H,1H3,(H2,25,27,28,30) |
| InChIKey | ZABZONNBYYBPHY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|