C16H14N4O2S — CID 6457260
N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]acetamide (PubChem CID 6457260) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 6457260 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[[2-methyl-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1cc(-c2nc3ncccc3o2)ccc1C |
| InChI | InChI=1S/C16H14N4O2S/c1-9-5-6-11(8-12(9)19-16(23)18-10(2)21)15-20-14-13(22-15)4-3-7-17-14/h3-8H,1-2H3,(H2,18,19,21,23) |
| InChIKey | DRFGGXVXCSYOKA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|