C20H12Cl2N4O2S — CID 1340989
2,4-dichloro-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 1340989) has the molecular formula C20H12Cl2N4O2S and a molecular weight of 443.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1340989 |
| Molecular Formula | C20H12Cl2N4O2S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2,4-dichloro-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3ncccc3o2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl2N4O2S/c21-12-6-7-14(15(22)10-12)18(27)26-20(29)24-13-4-1-3-11(9-13)19-25-17-16(28-19)5-2-8-23-17/h1-10H,(H2,24,26,27,29) |
| InChIKey | WZOOBYQZSQPYBZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|