C26H18ClN3O2S — CID 3587754
N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-2-chloro-4-methylbenzamide (PubChem CID 3587754) has the molecular formula C26H18ClN3O2S and a molecular weight of 471.97 g/mol. Its IUPAC name is N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-2-chloro-4-methylbenzamide.
| Compound Name | N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-2-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 3587754 |
| Molecular Formula | C26H18ClN3O2S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-2-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cccc(-c3nc4c(ccc5ccccc54)o3)c2)c(Cl)c1 |
| InChI | InChI=1S/C26H18ClN3O2S/c1-15-9-11-20(21(27)13-15)24(31)30-26(33)28-18-7-4-6-17(14-18)25-29-23-19-8-3-2-5-16(19)10-12-22(23)32-25/h2-14H,1H3,(H2,28,30,31,33) |
| InChIKey | MHKICXRMOYSAHG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|