C24H14ClN3O4 — CID 39380150
N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-chloro-5-nitrobenzamide (PubChem CID 39380150) has the molecular formula C24H14ClN3O4 and a molecular weight of 443.85 g/mol. Its IUPAC name is N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-chloro-5-nitrobenzamide.
| Compound Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 39380150 |
| Molecular Formula | C24H14ClN3O4 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-chloro-5-nitrobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3c(ccc4ccccc43)o2)c1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C24H14ClN3O4/c25-20-10-9-17(28(30)31)13-19(20)23(29)26-16-6-3-5-15(12-16)24-27-22-18-7-2-1-4-14(18)8-11-21(22)32-24/h1-13H,(H,26,29) |
| InChIKey | QQXJGYLJTLRISH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|