C24H15ClN2O2 — CID 40619533
N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-chlorobenzamide (PubChem CID 40619533) has the molecular formula C24H15ClN2O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-chlorobenzamide.
| Compound Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 40619533 |
| Molecular Formula | C24H15ClN2O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-chlorobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3c(ccc4ccccc43)o2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15ClN2O2/c25-18-11-8-16(9-12-18)23(28)26-19-6-3-5-17(14-19)24-27-22-20-7-2-1-4-15(20)10-13-21(22)29-24/h1-14H,(H,26,28) |
| InChIKey | QKWWZRYDTXEZBC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |