C24H14Cl2N2O2 — CID 39380118
N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2,5-dichlorobenzamide (PubChem CID 39380118) has the molecular formula C24H14Cl2N2O2 and a molecular weight of 433.29 g/mol. Its IUPAC name is N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2,5-dichlorobenzamide.
| Compound Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 39380118 |
| Molecular Formula | C24H14Cl2N2O2 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2,5-dichlorobenzamide |
| SMILES | O=C(Nc1cccc(-c2nc3c(ccc4ccccc43)o2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H14Cl2N2O2/c25-16-9-10-20(26)19(13-16)23(29)27-17-6-3-5-15(12-17)24-28-22-18-7-2-1-4-14(18)8-11-21(22)30-24/h1-13H,(H,27,29) |
| InChIKey | ORMKGPWCZLVQSK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |