C20H10Cl4N2O2 — CID 3095805
2,5-dichloro-N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 3095805) has the molecular formula C20H10Cl4N2O2 and a molecular weight of 452.12 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 3095805 |
| Molecular Formula | C20H10Cl4N2O2 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | 2,5-dichloro-N-[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H10Cl4N2O2/c21-11-2-5-14(22)13(8-11)19(27)25-12-3-6-18-17(9-12)26-20(28-18)10-1-4-15(23)16(24)7-10/h1-9H,(H,25,27) |
| InChIKey | QAEIXTPDHVACAD-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |