C21H12Cl2N2O3 — CID 17296891
2,4-dichloro-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzamide (PubChem CID 17296891) has the molecular formula C21H12Cl2N2O3 and a molecular weight of 411.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17296891 |
| Molecular Formula | C21H12Cl2N2O3 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 2,4-dichloro-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3c(=O)o2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H12Cl2N2O3/c22-13-8-9-15(17(23)11-13)19(26)24-14-5-3-4-12(10-14)20-25-18-7-2-1-6-16(18)21(27)28-20/h1-11H,(H,24,26) |
| InChIKey | VFINAYZCGMKOIF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |