C23H14N2O4 — CID 6496846
N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 6496846) has the molecular formula C23H14N2O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 6496846 |
| Molecular Formula | C23H14N2O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3c(=O)o2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H14N2O4/c26-21(20-13-14-6-1-4-11-19(14)28-20)24-16-8-5-7-15(12-16)22-25-18-10-3-2-9-17(18)23(27)29-22/h1-13H,(H,24,26) |
| InChIKey | PWVKCVOGQYJJPK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |