C19H16N2O4 — CID 27234711
(2R)-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]oxolane-2-carboxamide (PubChem CID 27234711) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2R)-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 27234711 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2R)-N-[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3c(=O)o2)c1)[C@H]1CCCO1 |
| InChI | InChI=1S/C19H16N2O4/c22-17(16-9-4-10-24-16)20-13-6-3-5-12(11-13)18-21-15-8-2-1-7-14(15)19(23)25-18/h1-3,5-8,11,16H,4,9-10H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | KACVDKSHNMKDPJ-MRXNPFEDSA-N |
| XLogP | 2.97 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |