C21H20N2O3 — CID 839397
N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]cyclohexanecarboxamide (PubChem CID 839397) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 839397 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3c(=O)o2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H20N2O3/c24-19(14-6-2-1-3-7-14)22-16-12-10-15(11-13-16)20-23-18-9-5-4-8-17(18)21(25)26-20/h4-5,8-14H,1-3,6-7H2,(H,22,24) |
| InChIKey | MUOFMCKBXCUBAB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |