C20H20N2O2 — CID 777186
N-[4-(1,3-benzoxazol-2-yl)phenyl]cyclohexanecarboxamide (PubChem CID 777186) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 777186 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H20N2O2/c23-19(14-6-2-1-3-7-14)21-16-12-10-15(11-13-16)20-22-17-8-4-5-9-18(17)24-20/h4-5,8-14H,1-3,6-7H2,(H,21,23) |
| InChIKey | FQDFUUIJCCZCCK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |