C24H18N2O5 — CID 17359655
[4-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]phenyl] propanoate (PubChem CID 17359655) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is [4-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]phenyl] propanoate.
| Compound Name | [4-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]phenyl] propanoate |
|---|---|
| PubChem CID | 17359655 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [4-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C(=O)Nc2cccc(-c3nc4ccccc4c(=O)o3)c2)cc1 |
| InChI | InChI=1S/C24H18N2O5/c1-2-21(27)30-18-12-10-15(11-13-18)22(28)25-17-7-5-6-16(14-17)23-26-20-9-4-3-8-19(20)24(29)31-23/h3-14H,2H2,1H3,(H,25,28) |
| InChIKey | HLIUZZAMBGNBDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|