C25H18N2O3 — CID 1047424
N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-methoxybenzamide (PubChem CID 1047424) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-methoxybenzamide.
| Compound Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 1047424 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(-c3nc4c(ccc5ccccc54)o3)c2)cc1 |
| InChI | InChI=1S/C25H18N2O3/c1-29-20-12-9-17(10-13-20)24(28)26-19-7-4-6-18(15-19)25-27-23-21-8-3-2-5-16(21)11-14-22(23)30-25/h2-15H,1H3,(H,26,28) |
| InChIKey | DBAFHEJNLZSQBR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |