C26H20N2O3 — CID 40618366
N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-(3-methylphenoxy)acetamide (PubChem CID 40618366) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-(3-methylphenoxy)acetamide.
| Compound Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 40618366 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(3-benzo[e][1,3]benzoxazol-2-ylphenyl)-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2cccc(-c3nc4c(ccc5ccccc54)o3)c2)c1 |
| InChI | InChI=1S/C26H20N2O3/c1-17-6-4-10-21(14-17)30-16-24(29)27-20-9-5-8-19(15-20)26-28-25-22-11-3-2-7-18(22)12-13-23(25)31-26/h2-15H,16H2,1H3,(H,27,29) |
| InChIKey | ROKPUPFRTCAMBB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |