C25H17N3O3S — CID 6035813
(E)-N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 6035813) has the molecular formula C25H17N3O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is (E)-N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6035813 |
| Molecular Formula | C25H17N3O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (E)-N-[(3-benzo[e][1,3]benzoxazol-2-ylphenyl)carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)Nc1cccc(-c2nc3c(ccc4ccccc43)o2)c1 |
| InChI | InChI=1S/C25H17N3O3S/c29-22(13-11-19-8-4-14-30-19)27-25(32)26-18-7-3-6-17(15-18)24-28-23-20-9-2-1-5-16(20)10-12-21(23)31-24/h1-15H,(H2,26,27,29,32)/b13-11+ |
| InChIKey | MOWIHKBIVPFFAQ-ACCUITESSA-N |
| XLogP | 5.77 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|