C21H17N3O3S — CID 1343643
N-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 1343643) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | N-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 1343643 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H17N3O3S/c25-19(12-11-18-10-5-13-27-18)24-21(28)23-17-9-4-8-16(14-17)22-20(26)15-6-2-1-3-7-15/h1-14H,(H,22,26)(H2,23,24,25,28)/b12-11+ |
| InChIKey | UFWOHKYBUARKCQ-VAWYXSNFSA-N |
| XLogP | 4.06 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|