C28H22N4O4S2 — CID 3789012
3-(furan-2-yl)-N-[[4-[4-[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]phenyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3789012) has the molecular formula C28H22N4O4S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[[4-[4-[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]phenyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[[4-[4-[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]phenyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3789012 |
| Molecular Formula | C28H22N4O4S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 3-(furan-2-yl)-N-[[4-[4-[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]phenyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)NC(=S)Nc1ccc(-c2ccc(NC(=S)NC(=O)C=Cc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C28H22N4O4S2/c33-25(15-13-23-3-1-17-35-23)31-27(37)29-21-9-5-19(6-10-21)20-7-11-22(12-8-20)30-28(38)32-26(34)16-14-24-4-2-18-36-24/h1-18H,(H2,29,31,33,37)(H2,30,32,34,38) |
| InChIKey | NAZRHVDEFNYCNN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|