C19H22N4O4S2 — CID 3881704
3-(furan-2-yl)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3881704) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3881704 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-(furan-2-yl)-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=S)NC(=O)C=Cc3ccco3)cc2)CC1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-29(25,26)23-12-10-22(11-13-23)16-6-4-15(5-7-16)20-19(28)21-18(24)9-8-17-3-2-14-27-17/h2-9,14H,10-13H2,1H3,(H2,20,21,24,28) |
| InChIKey | BMXCIHGNNALWPZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|