C26H27ClN4O4S2 — CID 21170068
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 21170068) has the molecular formula C26H27ClN4O4S2 and a molecular weight of 559.11 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 21170068 |
| Molecular Formula | C26H27ClN4O4S2 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccc(N4CCN(S(C)(=O)=O)CC4)cc3)o2)cc1Cl |
| InChI | InChI=1S/C26H27ClN4O4S2/c1-18-3-4-19(17-23(18)27)24-11-9-22(35-24)10-12-25(32)29-26(36)28-20-5-7-21(8-6-20)30-13-15-31(16-14-30)37(2,33)34/h3-12,17H,13-16H2,1-2H3,(H2,28,29,32,36)/b12-10+ |
| InChIKey | NSPUKBOUQXUZDW-ZRDIBKRKSA-N |
| XLogP | 4.52 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|