C21H17ClN2O2S — CID 19630661
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(phenylcarbamothioyl)prop-2-enamide (PubChem CID 19630661) has the molecular formula C21H17ClN2O2S and a molecular weight of 396.90 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(phenylcarbamothioyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(phenylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 19630661 |
| Molecular Formula | C21H17ClN2O2S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(phenylcarbamothioyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccccc3)o2)cc1Cl |
| InChI | InChI=1S/C21H17ClN2O2S/c1-14-7-8-15(13-18(14)22)19-11-9-17(26-19)10-12-20(25)24-21(27)23-16-5-3-2-4-6-16/h2-13H,1H3,(H2,23,24,25,27)/b12-10+ |
| InChIKey | IEWSNFJSDZCLBT-ZRDIBKRKSA-N |
| XLogP | 5.43 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|