C26H20ClN3O3S2 — CID 21167590
N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]thiophene-2-carboxamide (PubChem CID 21167590) has the molecular formula C26H20ClN3O3S2 and a molecular weight of 522.05 g/mol. Its IUPAC name is N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21167590 |
| Molecular Formula | C26H20ClN3O3S2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | N-[3-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cccc(NC(=O)c4cccs4)c3)o2)cc1Cl |
| InChI | InChI=1S/C26H20ClN3O3S2/c1-16-7-8-17(14-21(16)27)22-11-9-20(33-22)10-12-24(31)30-26(34)29-19-5-2-4-18(15-19)28-25(32)23-6-3-13-35-23/h2-15H,1H3,(H,28,32)(H2,29,30,31,34)/b12-10+ |
| InChIKey | WEAGHYKTDCUIEX-ZRDIBKRKSA-N |
| XLogP | 6.75 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|