C17H16N4O3S2 — CID 3718285
N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 3718285) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3718285 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-11(22)18-16(25)19-12-4-6-13(7-5-12)20-17(26)21-15(23)9-8-14-3-2-10-24-14/h2-10H,1H3,(H2,18,19,22,25)(H2,20,21,23,26) |
| InChIKey | NFJGUDCXRIDVNB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|