C19H18F3N3O3 — CID 17050595
(E)-3-(furan-2-yl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 17050595) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17050595 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H18F3N3O3/c20-19(21,22)18(27)25-11-9-24(10-12-25)15-5-3-14(4-6-15)23-17(26)8-7-16-2-1-13-28-16/h1-8,13H,9-12H2,(H,23,26)/b8-7+ |
| InChIKey | JDLIHXQUOZLIKG-BQYQJAHWSA-N |
| XLogP | 3.14 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|