C14H11F2NO4S — CID 7942006
(E)-N-[4-(difluoromethylsulfonyl)phenyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 7942006) has the molecular formula C14H11F2NO4S and a molecular weight of 327.31 g/mol. Its IUPAC name is (E)-N-[4-(difluoromethylsulfonyl)phenyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(difluoromethylsulfonyl)phenyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7942006 |
| Molecular Formula | C14H11F2NO4S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (E)-N-[4-(difluoromethylsulfonyl)phenyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H11F2NO4S/c15-14(16)22(19,20)12-6-3-10(4-7-12)17-13(18)8-5-11-2-1-9-21-11/h1-9,14H,(H,17,18)/b8-5+ |
| InChIKey | DYAYJUSNQYRDNZ-VMPITWQZSA-N |
| XLogP | 2.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|