C20H15F3N2O4S — CID 2572495
(E)-3-(furan-2-yl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enamide (PubChem CID 2572495) has the molecular formula C20H15F3N2O4S and a molecular weight of 436.41 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2572495 |
| Molecular Formula | C20H15F3N2O4S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H15F3N2O4S/c21-20(22,23)14-3-1-4-16(13-14)25-30(27,28)18-9-6-15(7-10-18)24-19(26)11-8-17-5-2-12-29-17/h1-13,25H,(H,24,26)/b11-8+ |
| InChIKey | RZXULTACRPMXIS-DHZHZOJOSA-N |
| XLogP | 4.75 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|