C20H24N2O4S — CID 7921854
(E)-N-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 7921854) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is (E)-N-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7921854 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (E)-N-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NC(=O)/C=C/c3ccco3)cc2)C1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-12-16(2)14-22(13-15)27(24,25)19-8-5-17(6-9-19)21-20(23)10-7-18-4-3-11-26-18/h3-11,15-16H,12-14H2,1-2H3,(H,21,23)/b10-7+/t15-,16+ |
| InChIKey | AJZKCHRLFYMNKB-BOWTUIMFSA-N |
| XLogP | 3.60 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|