C21H23FN2O4S — CID 42907834
(E)-N-[4-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 42907834) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is (E)-N-[4-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42907834 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-N-[4-(2,6-dimethylmorpholin-4-yl)sulfonylphenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(NC(=O)/C=C/c3ccc(F)cc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-15-13-24(14-16(2)28-15)29(26,27)20-10-8-19(9-11-20)23-21(25)12-5-17-3-6-18(22)7-4-17/h3-12,15-16H,13-14H2,1-2H3,(H,23,25)/b12-5+ |
| InChIKey | ZAGLDGFBWXZKAC-LFYBBSHMSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|