C16H16N2O3 — CID 2298592
(Z)-3-(furan-2-yl)-N-[4-(propanoylamino)phenyl]prop-2-enamide (PubChem CID 2298592) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is (Z)-3-(furan-2-yl)-N-[4-(propanoylamino)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-(furan-2-yl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2298592 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (Z)-3-(furan-2-yl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)/C=C\c2ccco2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-15(19)17-12-5-7-13(8-6-12)18-16(20)10-9-14-4-3-11-21-14/h3-11H,2H2,1H3,(H,17,19)(H,18,20)/b10-9- |
| InChIKey | IMESKJQNZVAWPB-KTKRTIGZSA-N |
| XLogP | 3.28 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|