C19H21N3O4 — CID 55802124
N-ethyl-4-[3-[3-(furan-2-yl)prop-2-enoylamino]propanoylamino]benzamide (PubChem CID 55802124) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-ethyl-4-[3-[3-(furan-2-yl)prop-2-enoylamino]propanoylamino]benzamide.
| Compound Name | N-ethyl-4-[3-[3-(furan-2-yl)prop-2-enoylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 55802124 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-ethyl-4-[3-[3-(furan-2-yl)prop-2-enoylamino]propanoylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)CCNC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-2-20-19(25)14-5-7-15(8-6-14)22-18(24)11-12-21-17(23)10-9-16-4-3-13-26-16/h3-10,13H,2,11-12H2,1H3,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | QQNYJSFMUJJSBZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|