C15H14FN3O3 — CID 75383403
N-(6-fluoro-3-pyridinyl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide (PubChem CID 75383403) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 75383403 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
| SMILES | O=C(/C=C/c1ccco1)NCCC(=O)Nc1ccc(F)nc1 |
| InChI | InChI=1S/C15H14FN3O3/c16-13-5-3-11(10-18-13)19-15(21)7-8-17-14(20)6-4-12-2-1-9-22-12/h1-6,9-10H,7-8H2,(H,17,20)(H,19,21)/b6-4+ |
| InChIKey | IFKRNEBAKZLOGE-GQCTYLIASA-N |
| XLogP | 1.97 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|