C8H9NO3 — CID 131239465
(E)-3-(furan-2-yl)-N-(hydroxymethyl)prop-2-enamide (PubChem CID 131239465) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(hydroxymethyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(hydroxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 131239465 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(hydroxymethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCO |
| InChI | InChI=1S/C8H9NO3/c10-6-9-8(11)4-3-7-2-1-5-12-7/h1-5,10H,6H2,(H,9,11)/b4-3+ |
| InChIKey | YSGBUNROIKLBGU-ONEGZZNKSA-N |
| XLogP | 0.36 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|