C10H13NO3 — CID 43389898
(E)-3-(furan-2-yl)-N-(3-hydroxypropyl)prop-2-enamide (PubChem CID 43389898) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(3-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(3-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 43389898 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(3-hydroxypropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCCCO |
| InChI | InChI=1S/C10H13NO3/c12-7-2-6-11-10(13)5-4-9-3-1-8-14-9/h1,3-5,8,12H,2,6-7H2,(H,11,13)/b5-4+ |
| InChIKey | NLCODQMJQIUKDI-SNAWJCMRSA-N |
| XLogP | 0.79 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|