C16H14F2N2O3 — CID 56789002
2,6-difluoro-N-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]ethyl]benzamide (PubChem CID 56789002) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]ethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56789002 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2,6-difluoro-N-[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]ethyl]benzamide |
| SMILES | O=C(/C=C/c1ccco1)NCCNC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2N2O3/c17-12-4-1-5-13(18)15(12)16(22)20-9-8-19-14(21)7-6-11-3-2-10-23-11/h1-7,10H,8-9H2,(H,19,21)(H,20,22)/b7-6+ |
| InChIKey | VOAKQYLFXBEWQB-VOTSOKGWSA-N |
| XLogP | 2.12 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|