C16H24N2O2 — CID 81483200
(E)-N-[2-(cycloheptylamino)ethyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 81483200) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E)-N-[2-(cycloheptylamino)ethyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(cycloheptylamino)ethyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 81483200 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (E)-N-[2-(cycloheptylamino)ethyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C16H24N2O2/c19-16(10-9-15-8-5-13-20-15)18-12-11-17-14-6-3-1-2-4-7-14/h5,8-10,13-14,17H,1-4,6-7,11-12H2,(H,18,19)/b10-9+ |
| InChIKey | BEAWKHPRTHGYAW-MDZDMXLPSA-N |
| XLogP | 2.72 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|