C10H11NO2 — CID 963880
(E)-N-cyclopropyl-3-(furan-2-yl)prop-2-enamide (PubChem CID 963880) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 963880 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (E)-N-cyclopropyl-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC1CC1 |
| InChI | InChI=1S/C10H11NO2/c12-10(11-8-3-4-8)6-5-9-2-1-7-13-9/h1-2,5-8H,3-4H2,(H,11,12)/b6-5+ |
| InChIKey | DMCCNZXKHMOIDY-AATRIKPKSA-N |
| XLogP | 1.57 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|