C18H18N2O3 — CID 95594085
(E)-N-[(3R)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 95594085) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (E)-N-[(3R)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3R)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 95594085 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (E)-N-[(3R)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)N[C@@H]1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H18N2O3/c21-17(9-8-16-7-4-10-23-16)19-15-11-18(22)20(13-15)12-14-5-2-1-3-6-14/h1-10,15H,11-13H2,(H,19,21)/b9-8+/t15-/m1/s1 |
| InChIKey | UQUOAXKWIALGLD-XVJNWHFHSA-N |
| XLogP | 2.21 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|