C10H12N2O2 — CID 77114393
N-(azetidin-3-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 77114393) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(azetidin-3-yl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-(azetidin-3-yl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 77114393 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(azetidin-3-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)NC1CNC1 |
| InChI | InChI=1S/C10H12N2O2/c13-10(12-8-6-11-7-8)4-3-9-2-1-5-14-9/h1-5,8,11H,6-7H2,(H,12,13) |
| InChIKey | MXEHZBCKNJDTIG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|