C18H27N3O2 — CID 108876584
3-(1-benzyl-5-oxopyrrolidin-3-yl)-1,1-dipropylurea (PubChem CID 108876584) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-(1-benzyl-5-oxopyrrolidin-3-yl)-1,1-dipropylurea.
| Compound Name | 3-(1-benzyl-5-oxopyrrolidin-3-yl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 108876584 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-(1-benzyl-5-oxopyrrolidin-3-yl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NC1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-3-10-20(11-4-2)18(23)19-16-12-17(22)21(14-16)13-15-8-6-5-7-9-15/h5-9,16H,3-4,10-14H2,1-2H3,(H,19,23) |
| InChIKey | LMJZVMOLAQEHAI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |